Systematic / IUPAC Name:
ID: Reference13704
Other Names: 9AntTSK4MeO
Formula: C23H19N3OS
3-[(E)-[(Anthracen-9-yl)methylidene]amino]-1-(4-methoxyphenyl)thiourea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD |
| No. of Spectral Trees | 1 |
| No. of Spectra | 544 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/26/2026 1:09:03 PM |
| InChI | InChI=1S/C23H19N3OS/c1-27-19-12-10-18(11-13-19)25-23(28)26-24-15-22-20-8-4-2-6-16(20)14-17-7-3-5-9-21(17)22/h2-15H,1H3,(H2,25,26,28)/b24-15+ |
| InChI Key | AVEARHIJWCUECU-BUVRLJJBSA-N |
| Canonical SMILES | COc1ccc(NC(=S)N/N=C/c2c3ccccc3cc3ccccc32)cc1 |
| CAS | |
| Splash | |
| Other Names | 9AntTSK4MeO |