Systematic / IUPAC Name:
ID: Reference13717
Other Names: 9AntMBA4F
Formula: C24H16FN3OS
(2Z)-2-[(2E)-2-[(Anthracen-9-yl)methylidene]hydrazin-1-ylidene]-3-(4-fluorophenyl)-1,3-thiazolidin-4-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2439 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/7/2026 9:27:32 AM |
| InChI | InChI=1S/C24H16FN3OS/c25-18-9-11-19(12-10-18)28-23(29)15-30-24(28)27-26-14-22-20-7-3-1-5-16(20)13-17-6-2-4-8-21(17)22/h1-14H,15H2/b26-14+,27-24- |
| InChI Key | LWMXBQLGWNCQAF-UQSUQEKASA-N |
| Canonical SMILES | O=C1CS/C(=N\N=C\c2c3ccccc3cc3ccccc32)N1c1ccc(F)cc1 |
| CAS | |
| Splash | |
| Other Names | 9AntMBA4F |