Systematic / IUPAC Name: 1,7-Dihydropyrazolo[5,4-d]pyrimidine-4,6-dione
ID: Reference13718
Other Names: AA-3710
Formula: C5H4N4O2
Class: Endogenous Metabolites
Oxypurinol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 680 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/7/2026 3:48:35 PM |
| InChI | InChI=1S/C5H4N4O2/c10-4-2-1-6-9-3(2)7-5(11)8-4/h1H,(H3,6,7,8,9,10,11) |
| InChI Key | HXNFUBHNUDHIGC-UHFFFAOYSA-N |
| Canonical SMILES | Oc1nc(O)c2cn[nH]c2n1 |
| CAS | |
| Splash | |
| Other Names | AA-3710 |
| HMDb | HMDB0000786 |
| ChEBI | CHEBI:28315 |
| Wikipedia | Oxipurinol |
| ChEMBL | CHEMBL859 |
| DrugBank | DB05262 |
| PubChem | 135398752 |
| KEGG | C07599 |
| ChemSpider | 4483 |