Systematic / IUPAC Name:
ID: Reference13719
Other Names: DHI-16
Formula: C17H13FN2O
3-[3-(4-Fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]--1H-indole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1669 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/13/2026 9:34:23 AM |
| InChI | InChI=1S/C17H13FN2O/c18-12-7-5-11(6-8-12)16-9-17(21-20-16)14-10-19-15-4-2-1-3-13(14)15/h1-8,10,17,19H,9H2 |
| InChI Key | BNSNMSSHFZVHCF-UHFFFAOYSA-N |
| Canonical SMILES | Fc1ccc(cc1)C=1CC(ON=1)c1c[NH]c2ccccc21 |
| CAS | |
| Splash | |
| Other Names | DHI-16 |