Systematic / IUPAC Name:
ID: Reference13721
Other Names: DHI-18
Formula: C18H15ClN2O2
3-[3-(4-Chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]-1-methoxy-1H-indole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1509 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/13/2026 9:24:27 AM |
| InChI | InChI=1S/C18H15ClN2O2/c1-22-21-11-15(14-4-2-3-5-17(14)21)18-10-16(20-23-18)12-6-8-13(19)9-7-12/h2-9,11,18H,10H2,1H3 |
| InChI Key | VKGDPHIWVLOXMB-UHFFFAOYSA-N |
| Canonical SMILES | COn1cc(C2CC(=NO2)c2ccc(Cl)cc2)c2ccccc21 |
| CAS | |
| Splash | |
| Other Names | DHI-18 |