Systematic / IUPAC Name: (2R)-2-Amino-3-(1H-imidazol-5-yl)propanoic acid
ID: Reference13723
Other Names: AA-3617
Formula: C6H9N3O2
Class: Endogenous Metabolites
D-Histidine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 260 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/14/2026 10:54:55 AM |
| InChI | InChI=1S/C6H9N3O2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1,7H2,(H,8,9)(H,10,11)/t5-/m1/s1 |
| InChI Key | HNDVDQJCIGZPNO-RXMQYKEDSA-N |
| Canonical SMILES | N[C@H](Cc1c[nH]cn1)C(=O)O |
| CAS | |
| Splash | |
| Other Names | AA-3617 |
| PubChem | 6971048 |
| ChEBI | CHEBI:27947 |
| KEGG | C06419 |
| ChEMBL | CHEMBL104875 |
| ChemSpider | 64237 |