Systematic / IUPAC Name: (2R,3S,4S,5R,6R)-2-(Hydroxymethyl)-6-methoxyoxane-3,4,5-triol
ID: Reference13724
Other Names:
AA-3626;
Methyl β-D-glucoside
Formula: C7H14O6
Class: Endogenous Metabolites
Methyl β-D-glucopyranoside mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 165 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/14/2026 11:19:18 AM |
| InChI | InChI=1S/C7H14O6/c1-12-7-6(11)5(10)4(9)3(2-8)13-7/h3-11H,2H2,1H3/t3-,4-,5+,6-,7-/m1/s1 |
| InChI Key | HOVAGTYPODGVJG-XUUWZHRGSA-N |
| Canonical SMILES | CO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
| CAS | |
| Splash | |
| Other Names |
AA-3626; Methyl β-D-glucoside |