Systematic / IUPAC Name: 4-[2-(Methylamino)ethyl]phenol
ID: Reference13726
Other Names: AA-3544
Formula: C9H13NO
Class: Endogenous Metabolites
N-Methyltyramine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 405 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/14/2026 2:37:13 PM |
| InChI | InChI=1S/C9H13NO/c1-10-7-6-8-2-4-9(11)5-3-8/h2-5,10-11H,6-7H2,1H3 |
| InChI Key | AXVZFRBSCNEKPQ-UHFFFAOYSA-N |
| Canonical SMILES | CNCCC1=CC=C(C=C1)O |
| CAS | |
| Splash | |
| Other Names | AA-3544 |