Systematic / IUPAC Name: (2S)-2-(Carbamoylamino)pentanedioic acid
ID: Reference13729
Other Names:
AA-3558;
N-Carbamyl-L-glutamic acid
Formula: C6H10N2O5
Class: Endogenous Metabolites
Carglumic Acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1300 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/14/2026 5:26:12 PM |
| InChI | InChI=1S/C6H10N2O5/c7-6(13)8-3(5(11)12)1-2-4(9)10/h3H,1-2H2,(H,9,10)(H,11,12)(H3,7,8,13)/t3-/m0/s1 |
| InChI Key | LCQLHJZYVOQKHU-VKHMYHEASA-N |
| Canonical SMILES | C(CC(=O)O)[C@@H](C(=O)O)NC(=O)N |
| CAS | |
| Splash | |
| Other Names |
AA-3558; N-Carbamyl-L-glutamic acid |