Systematic / IUPAC Name: Methyl 3-aminopyrazine-2-carboxylate
ID: Reference13731
Other Names: AA-3562
Formula: C6H7N3O2
Class: Endogenous Metabolites
Methyl 3-aminopyrazinecarboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 989 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/14/2026 5:50:18 PM |
| InChI | InChI=1S/C6H7N3O2/c1-11-6(10)4-5(7)9-3-2-8-4/h2-3H,1H3,(H2,7,9) |
| InChI Key | INCSQLZZXBPATR-UHFFFAOYSA-N |
| Canonical SMILES | COC(=O)C1=NC=CN=C1N |
| CAS | |
| Splash | |
| Other Names | AA-3562 |