Systematic / IUPAC Name: (2S)-2-(Dimethylamino)-3-methylbutanoic acid
ID: Reference13732
Other Names: AA-3564
Formula: C7H15NO2
Class: Endogenous Metabolites
N,N-Dimethyl-L-Valine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 265 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/14/2026 6:02:30 PM |
| InChI | InChI=1S/C7H15NO2/c1-5(2)6(7(9)10)8(3)4/h5-6H,1-4H3,(H,9,10)/t6-/m0/s1 |
| InChI Key | APGLTERDKORUHK-LURJTMIESA-N |
| Canonical SMILES | CC(C)[C@@H](C(=O)O)N(C)C |
| CAS | |
| Splash | |
| Other Names | AA-3564 |