Systematic / IUPAC Name: Pentanamide
ID: Reference13736
Other Names: AA-3831
Formula: C5H11NO
Class: Endogenous Metabolites
Valeramide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 105 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/16/2026 1:35:38 PM |
| InChI | InChI=1S/C5H11NO/c1-2-3-4-5(6)7/h2-4H2,1H3,(H2,6,7) |
| InChI Key | IPWFJLQDVFKJDU-UHFFFAOYSA-N |
| Canonical SMILES | CCCCC(N)=O |
| CAS | |
| Splash | |
| Other Names | AA-3831 |
| PubChem | 12298 |
| KEGG | C01842 |
| ChemSpider | 11795 |
| ChEBI | CHEBI:16459 |