Systematic / IUPAC Name: 3-[[(2R)-2,4-Dihydroxy-3,3-dimethylbutanoyl]amino]propanoic acid
ID: Reference13738
Other Names: AA-3834
Formula: C9H17NO5
Class: Endogenous Metabolites
D-Pantothenic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1889 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/16/2026 1:31:45 PM |
| InChI | InChI=1S/C9H17NO5/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13/h7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13)/t7-/m0/s1 |
| InChI Key | GHOKWGTUZJEAQD-ZETCQYMHSA-N |
| Canonical SMILES | CC(C)(CO)[C@@H](O)C(=O)NCCC(=O)O |
| CAS | |
| Splash | |
| Other Names | AA-3834 |
| ChemSpider | 6361 |
| PubChem | 6613 |
| HMDb | HMDB0000210 |
| KEGG | C00864 |
| ChEBI | CHEBI:46905 |
| Wikipedia | Pantothenic acid |
| ChEMBL | CHEMBL1594 |