Systematic / IUPAC Name: (2S,3S)-2-Acetamido-3-methylpentanoic acid
ID: Reference13739
Other Names: AA-3835
Formula: C8H15NO3
Class: Endogenous Metabolites
N-Acetyl-L-isoleucine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1500 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/16/2026 1:29:30 PM |
| InChI | InChI=1S/C8H15NO3/c1-4-5(2)7(8(11)12)9-6(3)10/h5,7H,4H2,1-3H3,(H,9,10)(H,11,12)/t5-,7-/m0/s1 |
| InChI Key | JDTWZSUNGHMMJM-FSPLSTOPSA-N |
| Canonical SMILES | CC[C@H](C)[C@H](NC(C)=O)C(=O)O |
| CAS | |
| Splash | |
| Other Names | AA-3835 |
| ChEMBL | CHEMBL1221841 |
| ChemSpider | 5397969 |
| PubChem | 7036275 |
| ChEBI | CHEBI:21555 |