Systematic / IUPAC Name: 3-(1H-Indol-3-yl)propanoic acid
ID: Reference13741
Other Names:
1H-Indole-3-propanoic acid;
AA-4019
Formula: C11H11NO2
Class: Endogenous Metabolites
3-Indolepropionic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1419 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/16/2026 1:43:47 PM |
| InChI | InChI=1S/C11H11NO2/c13-11(14)6-5-8-7-12-10-4-2-1-3-9(8)10/h1-4,7,12H,5-6H2,(H,13,14) |
| InChI Key | GOLXRNDWAUTYKT-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C(=CN2)CCC(=O)O |
| CAS | |
| Splash | |
| Other Names |
1H-Indole-3-propanoic acid; AA-4019 |
| HMDb | HMDB0002302 |
| ChEBI | CHEBI:43580 |
| DrugBank | DB02758 |
| KEGG | C22236 |
| PubChem | 3744; 3744 |
| ChemSpider | 3613 |
| ChEMBL | CHEMBL207225 |
| Wikipedia | 3-Indolepropionic acid |