Systematic / IUPAC Name:
ID: Reference13747
Other Names: MeO-TZD-4
Formula: C27H19N3O3S
(5E)-3-[(Acridin-4-yl)methyl]-5-[(1-methoxy-1H-indol-3-yl)methylidene]-1,3-thiazolidine-2,4-dione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD |
| No. of Spectral Trees | 1 |
| No. of Spectra | 735 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/19/2026 12:03:57 PM |
| InChI | InChI=1S/C27H19N3O3S/c1-33-30-16-20(21-10-3-5-12-23(21)30)14-24-26(31)29(27(32)34-24)15-19-9-6-8-18-13-17-7-2-4-11-22(17)28-25(18)19/h2-14,16H,15H2,1H3/b24-14- |
| InChI Key | HDBKJVYRLXANHO-OYKKKHCWSA-N |
| Canonical SMILES | O=C1S\C(=C/c2cn(OC)c3ccccc32)C(=O)N1Cc1cccc2cc3ccccc3nc12 |
| CAS | |
| Splash | |
| Other Names | MeO-TZD-4 |