Systematic / IUPAC Name: (2R,3R,3aR,6R,6aR)-2,3,6-Trihydroxy-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one
ID: Reference13748
Other Names: AA-3568
Formula: C6H8O6
Class: Endogenous Metabolites
D-Glucurono-3,6-Lactone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 521 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/21/2026 12:53:07 PM |
| InChI | InChI=1S/C6H8O6/c7-1-3-4(12-5(1)9)2(8)6(10)11-3/h1-5,7-9H/t1-,2-,3-,4-,5-/m1/s1 |
| InChI Key | OGLCQHRZUSEXNB-WHDMSYDLSA-N |
| Canonical SMILES | O[C@@H]1O[C@@H]2[C@@H](O)C(=O)O[C@@H]2[C@H]1O |
| CAS | |
| Splash | |
| Other Names | AA-3568 |