Systematic / IUPAC Name: 4-[4-[(2S,3R,4S,5S,6R)-3,4,5-Trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]butan-2-one
ID: Reference13749
Other Names: AA-3577
Formula: C16H22O7
Class: Endogenous Metabolites
Raspberryketone glucoside mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 215 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/21/2026 2:19:27 PM |
| InChI | InChI=1S/C16H22O7/c1-9(18)2-3-10-4-6-11(7-5-10)22-16-15(21)14(20)13(19)12(8-17)23-16/h4-7,12-17,19-21H,2-3,8H2,1H3/t12-,13-,14+,15-,16-/m1/s1 |
| InChI Key | IDONYWHRKBUDOR-IBEHDNSVSA-N |
| Canonical SMILES | CC(=O)CCc1ccc(cc1)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| CAS | |
| Splash | |
| Other Names | AA-3577 |