Systematic / IUPAC Name:
ID: Reference13756
Other Names: 1MeO4Cl
Formula: C18H14ClNO2
(E)-1-(4-Chlorophenyl)-3-(1-methoxy-1H-indol-3-yl)prop-2-en-1-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2355 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/26/2026 10:09:53 AM |
| InChI | InChI=1S/C18H14ClNO2/c1-22-20-12-14(16-4-2-3-5-17(16)20)8-11-18(21)13-6-9-15(19)10-7-13/h2-12H,1H3/b11-8+ |
| InChI Key | SGYQZVRKOPDPHF-DHZHZOJOSA-N |
| Canonical SMILES | Clc1ccc(cc1)C(=O)/C=C/c1cn(OC)c2ccccc21 |
| CAS | |
| Splash | |
| Other Names | 1MeO4Cl |