Systematic / IUPAC Name:
ID: Reference13758
Other Names: 1MeO-FerA-1
Formula: C20H20N2O4
(E)-3-(4-Hydroxy-3-methoxyphenyl)-N-((1-methoxy-1H-indol-3-yl)methyl)acrylamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD |
| No. of Spectral Trees | 2 |
| No. of Spectra | 4517 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/26/2026 9:40:45 AM |
| InChI | InChI=1S/C20H20N2O4/c1-25-19-11-14(7-9-18(19)23)8-10-20(24)21-12-15-13-22(26-2)17-6-4-3-5-16(15)17/h3-11,13,23H,12H2,1-2H3,(H,21,24)/b10-8+ |
| InChI Key | QEUSXSYCMORRIW-CSKARUKUSA-N |
| Canonical SMILES | Oc1ccc(cc1OC)/C=C/C(=O)NCc1cn(OC)c2ccccc21 |
| CAS | |
| Splash | |
| Other Names | 1MeO-FerA-1 |