Systematic / IUPAC Name: N-[1-[(2R,4S,5R)-4-Hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide
ID: Reference13760
Other Names: AA-3594
Formula: C11H15N3O5
Class: Endogenous Metabolites
N4-Acetyl-2'-deoxycytidine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 543 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/27/2026 12:43:26 PM |
| InChI | InChI=1S/C11H15N3O5/c1-6(16)12-9-2-3-14(11(18)13-9)10-4-7(17)8(5-15)19-10/h2-3,7-8,10,15,17H,4-5H2,1H3,(H,12,13,16,18)/t7-,8+,10+/m0/s1 |
| InChI Key | RWYFZABPLDFELM-QXFUBDJGSA-N |
| Canonical SMILES | CC(=O)Nc1ccn([C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)n1 |
| CAS | |
| Splash | |
| Other Names | AA-3594 |