Systematic / IUPAC Name: 7,8-Dimethyl-1H-benzo[g]pteridine-2,4-dione
ID: Reference13761
Other Names: AA-3542
Formula: C12H10N4O2
Class: Endogenous Metabolites
Lumichrome mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2107 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/27/2026 12:49:35 PM |
| InChI | InChI=1S/C12H10N4O2/c1-5-3-7-8(4-6(5)2)14-10-9(13-7)11(17)16-12(18)15-10/h3-4H,1-2H3,(H2,14,15,16,17,18) |
| InChI Key | ZJTJUVIJVLLGSP-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC2=C(C=C1C)N=C3C(=N2)C(=O)NC(=O)N3 |
| CAS | |
| Splash | |
| Other Names | AA-3542 |