Systematic / IUPAC Name: (1R,2R,4aS,8aS)-1-[(3R)-3-Hydroxy-3-methylpent-4-enyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol
ID: Reference13762
Other Names: AA-3756
Formula: C20H36O2
Class: Endogenous Metabolites
Sclareol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 545 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/28/2026 11:38:11 AM |
| InChI | InChI=1S/C20H36O2/c1-7-18(4,21)13-9-16-19(5)12-8-11-17(2,3)15(19)10-14-20(16,6)22/h7,15-16,21-22H,1,8-14H2,2-6H3/t15-,16+,18-,19-,20+/m0/s1 |
| InChI Key | XVULBTBTFGYVRC-HHUCQEJWSA-N |
| Canonical SMILES | C=C[C@](C)(O)CC[C@@H]1[C@@]2(C)CCCC(C)(C)[C@@H]2CC[C@@]1(C)O |
| CAS | |
| Splash | |
| Other Names | AA-3756 |
| PubChem | 163263 |
| ChEMBL | CHEMBL294740 |
| ChEBI | CHEBI:9053 |
| KEGG | C09183 |
| ChemSpider | 143282 |
| LipidsMAPs | LMPR0104030010 |
| Wikipedia | Sclareol |