Systematic / IUPAC Name: 6-Hydroxy-1H-pyridin-2-one
ID: Reference13767
Other Names: AA-3893
Formula: C5H5NO2
Class: Endogenous Metabolites
2,6-Dihydroxypyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 10 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/19/2026 1:36:44 PM |
| InChI | InChI=1S/C5H5NO2/c7-4-2-1-3-5(8)6-4/h1-3H,(H2,6,7,8) |
| InChI Key | WLFXSECCHULRRO-UHFFFAOYSA-N |
| Canonical SMILES | Oc1cccc(O)n1 |
| CAS | |
| Splash | |
| Other Names | AA-3893 |
| ChEMBL | CHEMBL3086507 |
| ChEBI | CHEBI:17681 |
| KEGG | C03056 |
| PubChem | 69371 |
| Wikipedia | 2,6-Dihydroxypyridine |
| ChemSpider | 62580 |