Systematic / IUPAC Name: 1,3,6,7-Tetrahydroxy-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]xanthen-9-one
ID: Reference13769
Other Names: AA-3861
Formula: C19H18O11
Class: Endogenous Metabolites
Mangiferin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 10233 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6, MS7 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/19/2026 1:32:45 PM |
| InChI | InChI=1S/C19H18O11/c20-4-11-15(25)17(27)18(28)19(30-11)12-8(23)3-10-13(16(12)26)14(24)5-1-6(21)7(22)2-9(5)29-10/h1-3,11,15,17-23,25-28H,4H2 |
| InChI Key | AEDDIBAIWPIIBD-UHFFFAOYSA-N |
| Canonical SMILES | O=c1c2cc(O)c(O)cc2oc2cc(O)c(C3OC(CO)C(O)C(O)C3O)c(O)c12 |
| CAS | |
| Splash | |
| Other Names | AA-3861 |
| PubChem | 5358385 |
| HMDb | HMDB34410 |
| ChemSpider | 4513535 |
| ChEMBL | CHEMBL1329826 |