Systematic / IUPAC Name: (Z)-4-Amino-4-oxobut-2-enoic acid
ID: Reference13771
Other Names: AA-3896
Formula: C4H5NO3
Class: Endogenous Metabolites
Maleamic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 310 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/19/2026 12:04:24 PM |
| InChI | InChI=1S/C4H5NO3/c5-3(6)1-2-4(7)8/h1-2H,(H2,5,6)(H,7,8)/b2-1- |
| InChI Key | FSQQTNAZHBEJLS-UPHRSURJSA-N |
| Canonical SMILES | NC(=O)/C=C\C(=O)O |
| CAS | |
| Splash | |
| Other Names | AA-3896 |
| PubChem | 5280451; 5280451 |
| KEGG | C01596 |
| ChEBI | CHEBI:29045 |
| ChemSpider | More details; 4444106 |