Systematic / IUPAC Name: 3-Methyl-1,3-dihydroindol-2-one
ID: Reference13772
Other Names: AA-3902
Formula: C9H9NO
Class: Endogenous Metabolites
3-Methyloxindole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 490 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/19/2026 11:57:40 AM |
| InChI | InChI=1S/C9H9NO/c1-6-7-4-2-3-5-8(7)10-9(6)11/h2-6H,1H3,(H,10,11) |
| InChI Key | BBZCPUCZKLTAJQ-UHFFFAOYSA-N |
| Canonical SMILES | CC1C(=O)Nc2ccccc21 |
| CAS | |
| Splash | |
| Other Names | AA-3902 |
| PubChem | 150923 |
| ChemSpider | 133020 |
| KEGG | C02366 |
| ChEBI | CHEBI:17397 |