Systematic / IUPAC Name: 3,13,21-Triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4,6,8,15,17,19-octaen-14-one
ID: Reference13773
Other Names: AA-3864
Formula: C18H13N3O
Class: Endogenous Metabolites
Rutaecarpine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1204 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/19/2026 11:52:48 AM |
| InChI | InChI=1S/C18H13N3O/c22-18-13-6-2-4-8-15(13)20-17-16-12(9-10-21(17)18)11-5-1-3-7-14(11)19-16/h1-8,19H,9-10H2 |
| InChI Key | ACVGWSKVRYFWRP-UHFFFAOYSA-N |
| Canonical SMILES | O=c1c2ccccc2nc2n1CCc1c-2[nH]c2ccccc12 |
| CAS | |
| Splash | |
| Other Names | AA-3864 |
| Wikipedia | Rutecarpine |
| HMDb | HMDB0042010 |
| KEGG | C09238 |
| ChEBI | CHEBI:8922 |
| PubChem | 65752 |
| ChEMBL | CHEMBL85139 |
| ChemSpider | 59175 |