Systematic / IUPAC Name: 1-(2,6-Dihydroxyphenyl)ethanone
ID: Reference13776
Other Names: AA-3872
Formula: C8H8O3
Class: Endogenous Metabolites
2-Acetylresorcinol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 605 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/19/2026 10:20:03 AM |
| InChI | InChI=1S/C8H8O3/c1-5(9)8-6(10)3-2-4-7(8)11/h2-4,10-11H,1H3 |
| InChI Key | YPTJKHVBDCRKNF-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)c1c(O)cccc1O |
| CAS | |
| Splash | |
| Other Names | AA-3872 |
| ChEMBL | CHEMBL454739 |
| ChemSpider | 62888 |
| HMDb | HMDB0029660 |
| PubChem | 69687 |