Systematic / IUPAC Name: Ethyl 2-(1H-indol-3-yl)acetate
ID: Reference13780
Other Names:
Ethyl indol-3-ylacetate;
Ethyl indole-3-acetate;
Indole-3-acetic acid ethyl ester;
Ethyl 1H-indole-3-acetate;
AA-3907
Formula: C12H13NO2
Class: Endogenous Metabolites
Ethyl 3-indoleacetate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 645 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/18/2026 12:15:35 PM |
| InChI | InChI=1S/C12H13NO2/c1-2-15-12(14)7-9-8-13-11-6-4-3-5-10(9)11/h3-6,8,13H,2,7H2,1H3 |
| InChI Key | HUDBDWIQSIGUDI-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)Cc1c[nH]c2ccccc12 |
| CAS | |
| Splash | |
| Other Names |
Ethyl indol-3-ylacetate; Ethyl indole-3-acetate; Indole-3-acetic acid ethyl ester; Ethyl 1H-indole-3-acetate; AA-3907 |
| PubChem | 13067 |
| ChEMBL | CHEMBL232508 |
| ChemSpider | 12523 |