Systematic / IUPAC Name: 1-(3-Hydroxyphenyl)ethanone
ID: Reference13781
Other Names: AA-3873
Formula: C8H8O2
Class: Endogenous Metabolites
3-Acetylphenol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 325 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/3/2026 2:56:04 PM |
| InChI | InChI=1S/C8H8O2/c1-6(9)7-3-2-4-8(10)5-7/h2-5,10H,1H3 |
| InChI Key | LUJMEECXHPYQOF-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)c1cccc(O)c1 |
| CAS | |
| Splash | |
| Other Names | AA-3873 |
| ChEMBL | CHEMBL404719 |
| PubChem | 8487; 8487 |
| Wikipedia | 3-Hydroxyacetophenone |
| ChemSpider | 8174 |