Systematic / IUPAC Name: 2-Piperidin-1-ylethyl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate
ID: Reference13782
Other Names: AA-3877
Formula: C24H25NO4
Class: Therapeutics/Prescription Drugs Endogenous Metabolites
Flavoxate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 868 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/3/2026 2:50:47 PM |
| InChI | InChI=1S/C24H25NO4/c1-17-21(26)19-11-8-12-20(23(19)29-22(17)18-9-4-2-5-10-18)24(27)28-16-15-25-13-6-3-7-14-25/h2,4-5,8-12H,3,6-7,13-16H2,1H3 |
| InChI Key | SPIUTQOUKAMGCX-UHFFFAOYSA-N |
| Canonical SMILES | Cc1c(-c2ccccc2)oc2c(C(=O)OCCN3CCCCC3)cccc2c1=O |
| CAS | |
| Splash | |
| Other Names | AA-3877 |
| KEGG | C07809 |
| ChEBI | CHEBI:5088 |
| ChemSpider | 3237 |
| ChEMBL | CHEMBL1493 |
| HMDb | HMDB0015279; HMDB0015279; HMDB0015279 |
| Wikipedia | Flavoxate |
| DrugBank | DB01148; DB01148 |
| PubChem | 3354 |