Systematic / IUPAC Name:
ID: Reference13787
Other Names:
3-Methyl-2-oxovaleric acid;
AA-3909
Formula: C6H10O3
Class: Endogenous Metabolites
(3S)-3-Methyl-2-oxopentanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 100 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/3/2026 2:12:44 PM |
| InChI | InChI=1S/C6H10O3/c1-3-4(2)5(7)6(8)9/h4H,3H2,1-2H3,(H,8,9)/t4-/m0/s1 |
| InChI Key | JVQYSWDUAOAHFM-BYPYZUCNSA-N |
| Canonical SMILES | CC[C@H](C)C(=O)C(=O)O |
| CAS | |
| Splash | |
| Other Names |
3-Methyl-2-oxovaleric acid; AA-3909 |
| PubChem | 439286 |
| ChemSpider | 388419 |
| ChEBI | CHEBI:15614 |
| KEGG | C00671 |