Systematic / IUPAC Name: Quinoline-4-carboxylic acid
ID: Reference13788
Other Names: AA-3910
Formula: C10H7NO2
Class: Endogenous Metabolites
4-Quinolinecarboxylic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 310 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/2/2026 9:58:10 PM |
| InChI | InChI=1S/C10H7NO2/c12-10(13)8-5-6-11-9-4-2-1-3-7(8)9/h1-6H,(H,12,13) |
| InChI Key | VQMSRUREDGBWKT-UHFFFAOYSA-N |
| Canonical SMILES | O=C(O)c1ccnc2ccccc12 |
| CAS | |
| Splash | |
| Other Names | AA-3910 |
| ChEBI | CHEBI:18311 |
| KEGG | C06414 |
| ChemSpider | 9826 |
| PubChem | 10243 |
| ChEMBL | CHEMBL4435617 |