Systematic / IUPAC Name: (2S)-2-Formamido-4-methylsulfanylbutanoic acid
ID: Reference1379
Other Names:
N-Formyl-L-methionine;
L-Methionine, N-formyl-
Formula: C6H11NO3S
N-Formylmethionine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 3 |
| No. of Spectra | 1880 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 6/12/2025 9:38:51 AM |
| InChI | InChI=1S/C6H11NO3S/c1-11-3-2-5(6(9)10)7-4-8/h4-5H,2-3H2,1H3,(H,7,8)(H,9,10)/t5-/m0/s1 |
| InChI Key | PYUSHNKNPOHWEZ-YFKPBYRVSA-N |
| Canonical SMILES | CSCCC(C(=O)O)NC=O |
| CAS | 4289989 |
| Splash | |
| Other Names |
N-Formyl-L-methionine; L-Methionine, N-formyl- |
| ChEBI | CHEBI:16552 |
| KEGG | C03145 |
| ChemSpider | 887 |
| PubChem | 439750 |