Systematic / IUPAC Name: 2-Phenylbutanoic acid
ID: Reference13796
Other Names: AA-3746
Formula: C10H12O2
Class: Endogenous Metabolites
2-Phenylbutyric acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 195 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/25/2026 7:21:43 PM |
| InChI | InChI=1S/C10H12O2/c1-2-9(10(11)12)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H,11,12) |
| InChI Key | OFJWFSNDPCAWDK-UHFFFAOYSA-N |
| Canonical SMILES | CCC(C(=O)O)c1ccccc1 |
| CAS | |
| Splash | |
| Other Names | AA-3746 |
| HMDb | HMDB0000329 |
| ChEMBL | CHEMBL1616045 |
| PubChem | 7012 |
| ChemSpider | 6745 |
| ChEBI | CHEBI:86545 |