Systematic / IUPAC Name: (Z)-3-(4-Hydroxyphenyl)-1-phenylprop-2-en-1-one
ID: Reference13797
Other Names:
4-Hydroxystyryl phenyl ketone;
AA-4095
Formula: C15H12O2
Class: Endogenous Metabolites
4'-Hydroxychalcone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1255 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/2/2026 9:38:49 PM |
| InChI | InChI=1S/C15H12O2/c16-14-9-6-12(7-10-14)8-11-15(17)13-4-2-1-3-5-13/h1-11,16H/b11-8- |
| InChI Key | PWWCDTYUYPOAIU-FLIBITNWSA-N |
| Canonical SMILES | O=C(/C=C\c1ccc(O)cc1)c1ccccc1 |
| CAS | |
| Splash | |
| Other Names |
4-Hydroxystyryl phenyl ketone; AA-4095 |
| HMDb | HMDB0032584 |
| PubChem | 25021769 |
| ChemSpider | 21428166 |