Systematic / IUPAC Name: 2-(4-Hydroxy-3-prop-2-enylphenyl)-4-prop-2-enylphenol
ID: Reference13798
Other Names: AA-4284
Formula: C18H18O2
Class: Endogenous Metabolites
Honokiol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 4788 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/27/2026 5:19:26 PM |
| InChI | InChI=1S/C18H18O2/c1-3-5-13-7-9-18(20)16(11-13)14-8-10-17(19)15(12-14)6-4-2/h3-4,7-12,19-20H,1-2,5-6H2 |
| InChI Key | FVYXIJYOAGAUQK-UHFFFAOYSA-N |
| Canonical SMILES | C=CCc1ccc(O)c(-c2ccc(O)c(CC=C)c2)c1 |
| CAS | |
| Splash | |
| Other Names | AA-4284 |
| ChEBI | CHEBI:5759 |
| Wikipedia | Honokiol |
| KEGG | C10630 |
| ChEMBL | CHEMBL16901 |
| PubChem | 72303 |
| ChemSpider | NOT-RMD-JTS-5; 65254 |