Systematic / IUPAC Name: (2S,4S,5R,6R)-2,4-Dihydroxy-5-[(2-hydroxyacetyl)amino]-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid
ID: Reference1380
Other Names:
N-Glycolylneuraminate;
Neuraminic acid, N-glycolyl-;
3,5-Dideoxy-5-[(hydroxyacetyl)amino]-D-glycero-D-galacto-2-nonulosonic acid ;
3,5-Dideoxy-5-(glycoloylamino)-D-glycero-β-D-galacto-non-2-ulopyranosonic acid
Formula: C11H19NO10
Class: Endogenous Metabolites
N-Glycolylneuraminic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 194 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/18/2016 12:27:32 PM |
| InChI | InChI=1S/C11H19NO10/c13-2-5(16)8(18)9-7(12-6(17)3-14)4(15)1-11(21,22-9)10(19)20/h4-5,7-9,13-16,18,21H,1-3H2,(H,12,17)(H,19,20)/t4-,5+,7+,8+,9+,11-/m0/s1 |
| InChI Key | FDJKUWYYUZCUJX-AJKRCSPLSA-N |
| Canonical SMILES | C1C(C(C(OC1(C(=O)O)O)C(C(CO)O)O)NC(=O)CO)O |
| CAS | 1113833 |
| Splash | |
| Other Names |
N-Glycolylneuraminate; Neuraminic acid, N-glycolyl-; 3,5-Dideoxy-5-[(hydroxyacetyl)amino]-D-glycero-D-galacto-2-nonulosonic acid ; 3,5-Dideoxy-5-(glycoloylamino)-D-glycero-β-D-galacto-non-2-ulopyranosonic acid |
| ChEBI | CHEBI:62084 |
| PubChem | 123802 |
| ChemIDPlus | 001113833 |
| Wikipedia | N-Glycolylneuraminic acid |
| HMDb | HMDB00833 |
| ChEMBL | CHEMBL496421 |
| ChemSpider | 3794850 |