Systematic / IUPAC Name:
ID: Reference13801
Other Names: AA-4290
Formula: C9H10O3
Class: Endogenous Metabolites
2,3-Dimethoxybenzaldehyde mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 853 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/27/2026 5:29:45 PM |
| InChI | InChI=1S/C9H10O3/c1-11-8-5-3-4-7(6-10)9(8)12-2/h3-6H,1-2H3 |
| InChI Key | JIVGSHFYXPRRSZ-UHFFFAOYSA-N |
| Canonical SMILES | COc1cccc(C=O)c1OC |
| CAS | |
| Splash | |
| Other Names | AA-4290 |
| ChemSpider | 59950 |
| ChEMBL | CHEMBL3039102 |
| PubChem | 66581 |