Systematic / IUPAC Name:
ID: Reference13803
Other Names: AA-4293
Formula: C8H10O2
Class: Endogenous Metabolites
5-Methoxy-2-methylphenol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 275 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/27/2026 5:31:16 PM |
| InChI | InChI=1S/C8H10O2/c1-6-3-4-7(10-2)5-8(6)9/h3-5,9H,1-2H3 |
| InChI Key | QXIOWYFFTWXSHE-UHFFFAOYSA-N |
| Canonical SMILES | COc1ccc(C)c(O)c1 |
| CAS | |
| Splash | |
| Other Names | AA-4293 |