Systematic / IUPAC Name: 2-Amino-3-(1H-indol-3-yl)propanamide
ID: Reference13805
Other Names: AA-3918
Formula: C11H13N3O
Class: Endogenous Metabolites
DL-Tryptophanamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1798 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/2/2026 9:34:30 PM |
| InChI | InChI=1S/C11H13N3O/c12-9(11(13)15)5-7-6-14-10-4-2-1-3-8(7)10/h1-4,6,9,14H,5,12H2,(H2,13,15) |
| InChI Key | JLSKPBDKNIXMBS-UHFFFAOYSA-N |
| Canonical SMILES | NC(=O)C(N)Cc1c[nH]c2ccccc12 |
| CAS | |
| Splash | |
| Other Names | AA-3918 |
| ChemSpider | 80647 |
| HMDb | HMDB0013318; HMDB0013318; HMDB0013318 |
| PubChem | 89366 |
| KEGG | C00977 |
| ChEMBL | CHEMBL1229086 |