Systematic / IUPAC Name: 1-(1H-Pyrrol-2-yl)ethanone
ID: Reference13812
Other Names: AA-4231
Formula: C6H7NO
Class: Endogenous Metabolites
2-Acetylpyrrole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 105 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/16/2026 7:41:28 PM |
| InChI | InChI=1S/C6H7NO/c1-5(8)6-3-2-4-7-6/h2-4,7H,1H3 |
| InChI Key | IGJQUJNPMOYEJY-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)c1ccc[nH]1 |
| CAS | |
| Splash | |
| Other Names | AA-4231 |
| ChEBI | CHEBI:59981 |
| ChemSpider | 13459 |
| ChEMBL | CHEMBL1414126 |
| PubChem | 14079; 14079 |
| HMDb | HMDB35882 |