Systematic / IUPAC Name: 3-Methylbutanamide
ID: Reference13813
Other Names: AA-3967
Formula: C5H11NO
Class: Endogenous Metabolites
Isovaleramide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 55 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/11/2026 4:00:11 PM |
| InChI | InChI=1S/C5H11NO/c1-4(2)3-5(6)7/h4H,3H2,1-2H3,(H2,6,7) |
| InChI Key | SANOUVWGPVYVAV-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)CC(N)=O |
| CAS | |
| Splash | |
| Other Names | AA-3967 |
| KEGG | D04637 |
| ChemSpider | 10467 |
| PubChem | 10930; 10930 |
| ChEMBL | CHEMBL171066 |
| Wikipedia | Isovaleramide |