Systematic / IUPAC Name: (2R)-2-Amino-4-methylpentanoic acid
ID: Reference13814
Other Names: AA-3762
Formula: C6H13NO2
Class: Endogenous Metabolites
D-Leucine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 365 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/11/2026 4:06:47 PM |
| InChI | InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m1/s1 |
| InChI Key | ROHFNLRQFUQHCH-RXMQYKEDSA-N |
| Canonical SMILES | CC(C)C[C@@H](N)C(=O)O |
| CAS | |
| Splash | |
| Other Names | AA-3762 |
| ChEBI | CHEBI:143079 |
| ChemSpider | 388617 |
| KEGG | C01570 |
| ChEMBL | CHEMBL1232258 |
| DrugBank | DB01746; DB01746 |
| PubChem | 6950207 |
| HMDb | HMDB0013773; HMDB0013773 |