Systematic / IUPAC Name: 2-Hydroxy-1-(4-hydroxyphenyl)ethanone
ID: Reference13815
Other Names: AA-3763
Formula: C8H8O3
Class: Endogenous Metabolites
2,4'-Dihydroxyacetophenone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 730 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/11/2026 4:35:14 PM |
| InChI | InChI=1S/C8H8O3/c9-5-8(11)6-1-3-7(10)4-2-6/h1-4,9-10H,5H2 |
| InChI Key | KLAKIAVEMQMVBT-UHFFFAOYSA-N |
| Canonical SMILES | O=C(CO)c1ccc(O)cc1 |
| CAS | |
| Splash | |
| Other Names | AA-3763 |
| ChEMBL | CHEMBL1908015 |
| ChEBI | CHEBI:35164 |
| PubChem | 440082 |
| KEGG | C13635 |
| HMDb | HMDB0029657 |
| ChemSpider | 389088 |