Systematic / IUPAC Name:
ID: Reference13816
Other Names: AA-3774
Formula: C9H10O3
Class: Endogenous Metabolites
2-(4-Hydroxyphenyl)propionic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 225 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/11/2026 4:39:42 PM |
| InChI | InChI=1S/C9H10O3/c1-6(9(11)12)7-2-4-8(10)5-3-7/h2-6,10H,1H3,(H,11,12) |
| InChI Key | ZHMMPVANGNPCBW-UHFFFAOYSA-N |
| Canonical SMILES | CC(C(=O)O)c1ccc(O)cc1 |
| CAS | |
| Splash | |
| Other Names | AA-3774 |
| PubChem | 102526; 102526 |
| KEGG | C03080 |
| ChEMBL | CHEMBL188281 |
| ChEBI | CHEBI:1868 |
| ChemSpider | 92601 |
| HMDb | HMDB0041683; HMDB0041683; HMDB0041683 |