Systematic / IUPAC Name: 2-Propylpentanoic acid
ID: Reference13817
Other Names: AA-3783
Formula: C8H16O2
Class: Therapeutics/Prescription Drugs Sports Doping Drugs Endogenous Metabolites
Valproic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 70 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/11/2026 4:45:36 PM |
| InChI | InChI=1S/C8H16O2/c1-3-5-7(6-4-2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10) |
| InChI Key | NIJJYAXOARWZEE-UHFFFAOYSA-N |
| Canonical SMILES | CCCC(CCC)C(=O)O |
| CAS | |
| Splash | |
| Other Names | AA-3783 |
| KEGG | C07185 |
| Wikipedia | Valproic acid |
| PubChem | 3121; 3121 |
| LipidsMAPs | LMFA01020291 |
| ChemSpider | Depakene; 3009 |
| ChEBI | CHEBI:39867 |
| ChEMBL | CHEMBL109 |
| HMDb | HMDB0001877; HMDB0001877 |
| DrugBank | DB00313; DB00313 |