Systematic / IUPAC Name:
ID: Reference13818
Other Names: AA-3801
Formula: C6H13NO
Class: Endogenous Metabolites
Hexanamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 165 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/11/2026 4:48:57 PM |
| InChI | InChI=1S/C6H13NO/c1-2-3-4-5-6(7)8/h2-5H2,1H3,(H2,7,8) |
| InChI Key | ALBYIUDWACNRRB-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCC(N)=O |
| CAS | |
| Splash | |
| Other Names | AA-3801 |
| ChEBI | CHEBI:142683 |
| ChemSpider | More details; 11827 |
| ChEMBL | CHEMBL1523958 |
| PubChem | 12332; 12332 |