Systematic / IUPAC Name: (2R)-2,5-Diaminopentanoic acid
ID: Reference13824
Other Names:
Ornithine, D-;
(R)-Ornithine;
AA-4296
Formula: C5H12N2O2
Class: Endogenous Metabolites
D-Ornithine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 600 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/12/2026 3:13:09 PM |
| InChI | InChI=1S/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/t4-/m1/s1 |
| InChI Key | AHLPHDHHMVZTML-SCSAIBSYSA-N |
| Canonical SMILES | NCCC[C@@H](N)C(=O)O |
| CAS | |
| Splash | |
| Other Names |
Ornithine, D-; (R)-Ornithine; AA-4296 |
| ChEBI | CHEBI:16176 |
| ChemSpider | 64236 |
| ChEMBL | CHEMBL103686 |
| PubChem | 71082 |
| KEGG | C00515 |
| HMDb | HMDB0003374; HMDB0003374; HMDB0003374 |